C29H38BrN5O2 — CID 155140235
8-bromo-2-butyl-N-[(2,4-dimethoxyphenyl)methyl]-1-[4-(dimethylamino)butyl]imidazo[4,5-c]quinolin-4-amine (PubChem CID 155140235) has the molecular formula C29H38BrN5O2 and a molecular weight of 568.56 g/mol. Its IUPAC name is 8-bromo-2-butyl-N-[(2,4-dimethoxyphenyl)methyl]-1-[4-(dimethylamino)butyl]imidazo[4,5-c]quinolin-4-amine.
| Compound Name | 8-bromo-2-butyl-N-[(2,4-dimethoxyphenyl)methyl]-1-[4-(dimethylamino)butyl]imidazo[4,5-c]quinolin-4-amine |
|---|---|
| PubChem CID | 155140235 |
| Molecular Formula | C29H38BrN5O2 |
| Molecular Weight | 568.56 g/mol |
| Exact Mass | 567.22 |
| IUPAC Name | 8-bromo-2-butyl-N-[(2,4-dimethoxyphenyl)methyl]-1-[4-(dimethylamino)butyl]imidazo[4,5-c]quinolin-4-amine |
| SMILES | CCCCc1nc2c(NCc3ccc(OC)cc3OC)nc3ccc(Br)cc3c2n1CCCCN(C)C |
| InChI | InChI=1S/C29H38BrN5O2/c1-6-7-10-26-33-27-28(35(26)16-9-8-15-34(2)3)23-17-21(30)12-14-24(23)32-29(27)31-19-20-11-13-22(36-4)18-25(20)37-5/h11-14,17-18H,6-10,15-16,19H2,1-5H3,(H,31,32) |
| InChIKey | LQYKRWODUKTLMZ-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 64.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.56 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|