C10H15NO — CID 155140279
(3Z,5Z)-3-(methylaminomethyl)octa-1,3,5,7-tetraen-4-ol (PubChem CID 155140279) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is (3Z,5Z)-3-(methylaminomethyl)octa-1,3,5,7-tetraen-4-ol.
| Compound Name | (3Z,5Z)-3-(methylaminomethyl)octa-1,3,5,7-tetraen-4-ol |
|---|---|
| PubChem CID | 155140279 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | (3Z,5Z)-3-(methylaminomethyl)octa-1,3,5,7-tetraen-4-ol |
| SMILES | C=C/C=C\C(O)=C(/C=C)CNC |
| InChI | InChI=1S/C10H15NO/c1-4-6-7-10(12)9(5-2)8-11-3/h4-7,11-12H,1-2,8H2,3H3/b7-6-,10-9- |
| InChIKey | NZCMETQXWQLDIH-HZJYTTRNSA-N |
| XLogP | 1.95 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|