About (R)-1,3-dithian-2-yl-[(2R)-pyrrolidin-2-yl]methanol
(R)-1,3-dithian-2-yl-[(2R)-pyrrolidin-2-yl]methanol (PubChem CID 155141445) has the molecular formula C9H17NOS2
and a molecular weight of 219.37 g/mol. Its IUPAC name is (R)-1,3-dithian-2-yl-[(2R)-pyrrolidin-2-yl]methanol.
Molecular Properties
| Compound Name | (R)-1,3-dithian-2-yl-[(2R)-pyrrolidin-2-yl]methanol |
| PubChem CID | 155141445 |
| Molecular Formula | C9H17NOS2 |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | (R)-1,3-dithian-2-yl-[(2R)-pyrrolidin-2-yl]methanol |
| SMILES | O[C@@H](C1SCCCS1)[C@H]1CCCN1 |
| InChI | InChI=1S/C9H17NOS2/c11-8(7-3-1-4-10-7)9-12-5-2-6-13-9/h7-11H,1-6H2/t7-,8-/m1/s1 |
| InChIKey | FQTGDSWCQNOMFP-HTQZYQBOSA-N |
| XLogP | 1.30 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (R)-1,3-dithian-2-yl-[(2R)-pyrrolidin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (R)-1,3-dithian-2-yl-[(2R)-pyrrolidin-2-yl]methanol?
The IUPAC name of (R)-1,3-dithian-2-yl-[(2R)-pyrrolidin-2-yl]methanol (CID 155141445) is (R)-1,3-dithian-2-yl-[(2R)-pyrrolidin-2-yl]methanol.
What is the SMILES notation for (R)-1,3-dithian-2-yl-[(2R)-pyrrolidin-2-yl]methanol?
The canonical SMILES for (R)-1,3-dithian-2-yl-[(2R)-pyrrolidin-2-yl]methanol is O[C@@H](C1SCCCS1)[C@H]1CCCN1.
What is the InChIKey of (R)-1,3-dithian-2-yl-[(2R)-pyrrolidin-2-yl]methanol?
The InChIKey is FQTGDSWCQNOMFP-HTQZYQBOSA-N. The full InChI is InChI=1S/C9H17NOS2/c11-8(7-3-1-4-10-7)9-12-5-2-6-13-9/h7-11H,1-6H2/t7-,8-/m1/s1.
What are the key properties of (R)-1,3-dithian-2-yl-[(2R)-pyrrolidin-2-yl]methanol?
(R)-1,3-dithian-2-yl-[(2R)-pyrrolidin-2-yl]methanol has a molecular weight of 219.37 g/mol, XLogP of 1.30, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (R)-1,3-dithian-2-yl-[(2R)-pyrrolidin-2-yl]methanol is sourced from PubChem (CID 155141445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).