C21H26F3N3O5 — CID 155141965
6-[2-methyl-3-[[2-methyl-4-(trifluoromethoxy)phenyl]methoxy]azetidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one (PubChem CID 155141965) has the molecular formula C21H26F3N3O5 and a molecular weight of 457.45 g/mol. Its IUPAC name is 6-[2-methyl-3-[[2-methyl-4-(trifluoromethoxy)phenyl]methoxy]azetidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one.
| Compound Name | 6-[2-methyl-3-[[2-methyl-4-(trifluoromethoxy)phenyl]methoxy]azetidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 155141965 |
| Molecular Formula | C21H26F3N3O5 |
| Molecular Weight | 457.45 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | 6-[2-methyl-3-[[2-methyl-4-(trifluoromethoxy)phenyl]methoxy]azetidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one |
| SMILES | Cc1cc(OC(F)(F)F)ccc1COC1CN(C(=O)N2CCC3OCC(=O)NC3C2)C1C |
| InChI | InChI=1S/C21H26F3N3O5/c1-12-7-15(32-21(22,23)24)4-3-14(12)10-30-18-9-27(13(18)2)20(29)26-6-5-17-16(8-26)25-19(28)11-31-17/h3-4,7,13,16-18H,5-6,8-11H2,1-2H3,(H,25,28) |
| InChIKey | VNVARSHCCRBGRX-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.45 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |