C16H13N5OS — CID 155142211
3-(2-phenylimino-3,6-dihydro-1,3,4-thiadiazin-5-yl)-1H-benzimidazol-2-one (PubChem CID 155142211) has the molecular formula C16H13N5OS and a molecular weight of 323.38 g/mol. Its IUPAC name is 3-(2-phenylimino-3,6-dihydro-1,3,4-thiadiazin-5-yl)-1H-benzimidazol-2-one.
| Compound Name | 3-(2-phenylimino-3,6-dihydro-1,3,4-thiadiazin-5-yl)-1H-benzimidazol-2-one |
|---|---|
| PubChem CID | 155142211 |
| Molecular Formula | C16H13N5OS |
| Molecular Weight | 323.38 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 3-(2-phenylimino-3,6-dihydro-1,3,4-thiadiazin-5-yl)-1H-benzimidazol-2-one |
| SMILES | O=c1[nH]c2ccccc2n1C1=NN/C(=N/c2ccccc2)SC1 |
| InChI | InChI=1S/C16H13N5OS/c22-16-18-12-8-4-5-9-13(12)21(16)14-10-23-15(20-19-14)17-11-6-2-1-3-7-11/h1-9H,10H2,(H,17,20)(H,18,22) |
| InChIKey | QKQFKISSSQGDBZ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 74.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.38 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_urea_L(1)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|