C23H43IO5 — CID 155142710
[(E)-12-hydroxy-1-iodo-4,10-dimethoxy-3,5,9-trimethyltetradec-1-en-6-yl] 2-methylpropanoate (PubChem CID 155142710) has the molecular formula C23H43IO5 and a molecular weight of 526.50 g/mol. Its IUPAC name is [(E)-12-hydroxy-1-iodo-4,10-dimethoxy-3,5,9-trimethyltetradec-1-en-6-yl] 2-methylpropanoate.
| Compound Name | [(E)-12-hydroxy-1-iodo-4,10-dimethoxy-3,5,9-trimethyltetradec-1-en-6-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 155142710 |
| Molecular Formula | C23H43IO5 |
| Molecular Weight | 526.50 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | [(E)-12-hydroxy-1-iodo-4,10-dimethoxy-3,5,9-trimethyltetradec-1-en-6-yl] 2-methylpropanoate |
| SMILES | CCC(O)CC(OC)C(C)CCC(OC(=O)C(C)C)C(C)C(OC)C(C)/C=C/I |
| InChI | InChI=1S/C23H43IO5/c1-9-19(25)14-21(27-7)16(4)10-11-20(29-23(26)15(2)3)18(6)22(28-8)17(5)12-13-24/h12-13,15-22,25H,9-11,14H2,1-8H3/b13-12+ |
| InChIKey | KWOZRAVNXPNTOJ-OUKQBFOZSA-N |
| XLogP | 5.38 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.50 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|