C26H49IO5 — CID 155142793
[(E,3R,4R,5S,6R,9S,10S,12R)-1-iodo-4,10-dimethoxy-3,5,9-trimethyl-12-propoxytetradec-1-en-6-yl] 2-methylpropanoate (PubChem CID 155142793) has the molecular formula C26H49IO5 and a molecular weight of 568.58 g/mol. Its IUPAC name is [(E,3R,4R,5S,6R,9S,10S,12R)-1-iodo-4,10-dimethoxy-3,5,9-trimethyl-12-propoxytetradec-1-en-6-yl] 2-methylpropanoate.
| Compound Name | [(E,3R,4R,5S,6R,9S,10S,12R)-1-iodo-4,10-dimethoxy-3,5,9-trimethyl-12-propoxytetradec-1-en-6-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 155142793 |
| Molecular Formula | C26H49IO5 |
| Molecular Weight | 568.58 g/mol |
| Exact Mass | 568.26 |
| IUPAC Name | [(E,3R,4R,5S,6R,9S,10S,12R)-1-iodo-4,10-dimethoxy-3,5,9-trimethyl-12-propoxytetradec-1-en-6-yl] 2-methylpropanoate |
| SMILES | CCCO[C@H](CC)C[C@H](OC)[C@@H](C)CC[C@@H](OC(=O)C(C)C)[C@H](C)[C@H](OC)[C@H](C)/C=C/I |
| InChI | InChI=1S/C26H49IO5/c1-10-16-31-22(11-2)17-24(29-8)19(5)12-13-23(32-26(28)18(3)4)21(7)25(30-9)20(6)14-15-27/h14-15,18-25H,10-13,16-17H2,1-9H3/b15-14+/t19-,20+,21-,22+,23+,24-,25+/m0/s1 |
| InChIKey | JDQXMNIKZSDQEC-RLOBBASXSA-N |
| XLogP | 6.82 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.58 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|