C50H71NO9S — CID 155142840
[(E)-1-[formyl(methyl)amino]-4,10-dimethoxy-3,5,9-trimethyl-12-[2-[2-(2-tritylsulfanylethoxy)ethoxy]acetyl]oxytetradec-1-en-6-yl] 2-methylpropanoate (PubChem CID 155142840) has the molecular formula C50H71NO9S and a molecular weight of 862.18 g/mol. Its IUPAC name is [(E)-1-[formyl(methyl)amino]-4,10-dimethoxy-3,5,9-trimethyl-12-[2-[2-(2-tritylsulfanylethoxy)ethoxy]acetyl]oxytetradec-1-en-6-yl] 2-methylpropanoate.
| Compound Name | [(E)-1-[formyl(methyl)amino]-4,10-dimethoxy-3,5,9-trimethyl-12-[2-[2-(2-tritylsulfanylethoxy)ethoxy]acetyl]oxytetradec-1-en-6-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 155142840 |
| Molecular Formula | C50H71NO9S |
| Molecular Weight | 862.18 g/mol |
| Exact Mass | 861.48 |
| IUPAC Name | [(E)-1-[formyl(methyl)amino]-4,10-dimethoxy-3,5,9-trimethyl-12-[2-[2-(2-tritylsulfanylethoxy)ethoxy]acetyl]oxytetradec-1-en-6-yl] 2-methylpropanoate |
| SMILES | CCC(CC(OC)C(C)CCC(OC(=O)C(C)C)C(C)C(OC)C(C)/C=C/N(C)C=O)OC(=O)COCCOCCSC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C50H71NO9S/c1-10-44(34-46(55-8)38(4)26-27-45(60-49(54)37(2)3)40(6)48(56-9)39(5)28-29-51(7)36-52)59-47(53)35-58-31-30-57-32-33-61-50(41-20-14-11-15-21-41,42-22-16-12-17-23-42)43-24-18-13-19-25-43/h11-25,28-29,36-40,44-46,48H,10,26-27,30-35H2,1-9H3/b29-28+ |
| InChIKey | WNPXYGRJMLQGAB-ZQHSETAFSA-N |
| XLogP | 9.35 |
| TPSA | 109.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 862.18 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|