C20H18F5IN4O — CID 155143193
(3R,4R)-1-[1-[[2-(difluoromethoxy)phenyl]methyl]-5,6-difluoro-4-iodobenzimidazol-2-yl]-4-fluoropiperidin-3-amine (PubChem CID 155143193) has the molecular formula C20H18F5IN4O and a molecular weight of 552.29 g/mol. Its IUPAC name is (3R,4R)-1-[1-[[2-(difluoromethoxy)phenyl]methyl]-5,6-difluoro-4-iodobenzimidazol-2-yl]-4-fluoropiperidin-3-amine.
| Compound Name | (3R,4R)-1-[1-[[2-(difluoromethoxy)phenyl]methyl]-5,6-difluoro-4-iodobenzimidazol-2-yl]-4-fluoropiperidin-3-amine |
|---|---|
| PubChem CID | 155143193 |
| Molecular Formula | C20H18F5IN4O |
| Molecular Weight | 552.29 g/mol |
| Exact Mass | 552.04 |
| IUPAC Name | (3R,4R)-1-[1-[[2-(difluoromethoxy)phenyl]methyl]-5,6-difluoro-4-iodobenzimidazol-2-yl]-4-fluoropiperidin-3-amine |
| SMILES | N[C@@H]1CN(c2nc3c(I)c(F)c(F)cc3n2Cc2ccccc2OC(F)F)CC[C@H]1F |
| InChI | InChI=1S/C20H18F5IN4O/c21-11-5-6-29(9-13(11)27)20-28-18-14(7-12(22)16(23)17(18)26)30(20)8-10-3-1-2-4-15(10)31-19(24)25/h1-4,7,11,13,19H,5-6,8-9,27H2/t11-,13-/m1/s1 |
| InChIKey | ANYSTKCNZGCXED-DGCLKSJQSA-N |
| XLogP | 4.44 |
| TPSA | 56.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.29 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|