C31H39F3N4O5S2 — CID 155144185
N-[5-(2-ethylsulfonyl-2-propan-2-ylhydrazinyl)-5-oxopentyl]-N-[(1S)-1-[3-(3-methyl-4-pyridinyl)phenyl]ethyl]-2-(trifluoromethyl)benzenesulfonamide (PubChem CID 155144185) has the molecular formula C31H39F3N4O5S2 and a molecular weight of 668.80 g/mol. Its IUPAC name is N-[5-(2-ethylsulfonyl-2-propan-2-ylhydrazinyl)-5-oxopentyl]-N-[(1S)-1-[3-(3-methyl-4-pyridinyl)phenyl]ethyl]-2-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[5-(2-ethylsulfonyl-2-propan-2-ylhydrazinyl)-5-oxopentyl]-N-[(1S)-1-[3-(3-methyl-4-pyridinyl)phenyl]ethyl]-2-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 155144185 |
| Molecular Formula | C31H39F3N4O5S2 |
| Molecular Weight | 668.80 g/mol |
| Exact Mass | 668.23 |
| IUPAC Name | N-[5-(2-ethylsulfonyl-2-propan-2-ylhydrazinyl)-5-oxopentyl]-N-[(1S)-1-[3-(3-methyl-4-pyridinyl)phenyl]ethyl]-2-(trifluoromethyl)benzenesulfonamide |
| SMILES | CCS(=O)(=O)N(NC(=O)CCCCN([C@@H](C)c1cccc(-c2ccncc2C)c1)S(=O)(=O)c1ccccc1C(F)(F)F)C(C)C |
| InChI | InChI=1S/C31H39F3N4O5S2/c1-6-44(40,41)38(22(2)3)36-30(39)16-9-10-19-37(45(42,43)29-15-8-7-14-28(29)31(32,33)34)24(5)25-12-11-13-26(20-25)27-17-18-35-21-23(27)4/h7-8,11-15,17-18,20-22,24H,6,9-10,16,19H2,1-5H3,(H,36,39)/t24-/m0/s1 |
| InChIKey | UXYQKNHQRJHLGM-DEOSSOPVSA-N |
| XLogP | 6.09 |
| TPSA | 116.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.80 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|