C17H23F3N3O5P — CID 155144232
[methylamino-[1-(3-methylbutyl)-5-[(2,4,5-trifluorophenyl)methoxy]pyrazol-3-yl]methyl] dihydrogen phosphate (PubChem CID 155144232) has the molecular formula C17H23F3N3O5P and a molecular weight of 437.36 g/mol. Its IUPAC name is [methylamino-[1-(3-methylbutyl)-5-[(2,4,5-trifluorophenyl)methoxy]pyrazol-3-yl]methyl] dihydrogen phosphate.
| Compound Name | [methylamino-[1-(3-methylbutyl)-5-[(2,4,5-trifluorophenyl)methoxy]pyrazol-3-yl]methyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 155144232 |
| Molecular Formula | C17H23F3N3O5P |
| Molecular Weight | 437.36 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | [methylamino-[1-(3-methylbutyl)-5-[(2,4,5-trifluorophenyl)methoxy]pyrazol-3-yl]methyl] dihydrogen phosphate |
| SMILES | CNC(OP(=O)(O)O)c1cc(OCc2cc(F)c(F)cc2F)n(CCC(C)C)n1 |
| InChI | InChI=1S/C17H23F3N3O5P/c1-10(2)4-5-23-16(8-15(22-23)17(21-3)28-29(24,25)26)27-9-11-6-13(19)14(20)7-12(11)18/h6-8,10,17,21H,4-5,9H2,1-3H3,(H2,24,25,26) |
| InChIKey | OWLSJAYVSMXYBU-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.36 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|