About (5Z)-5-hydroxyimino-4-phenyl-2-[4-(trifluoromethyl)phenyl]cyclopenta-1,3-diene-1-carbonitrile
(5Z)-5-hydroxyimino-4-phenyl-2-[4-(trifluoromethyl)phenyl]cyclopenta-1,3-diene-1-carbonitrile (PubChem CID 155144336) has the molecular formula C19H11F3N2O
and a molecular weight of 340.30 g/mol. Its IUPAC name is (5Z)-5-hydroxyimino-4-phenyl-2-[4-(trifluoromethyl)phenyl]cyclopenta-1,3-diene-1-carbonitrile.
Molecular Properties
| Compound Name | (5Z)-5-hydroxyimino-4-phenyl-2-[4-(trifluoromethyl)phenyl]cyclopenta-1,3-diene-1-carbonitrile |
| PubChem CID | 155144336 |
| Molecular Formula | C19H11F3N2O |
| Molecular Weight | 340.30 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | (5Z)-5-hydroxyimino-4-phenyl-2-[4-(trifluoromethyl)phenyl]cyclopenta-1,3-diene-1-carbonitrile |
| SMILES | N#CC1=C(c2ccc(C(F)(F)F)cc2)C=C(c2ccccc2)/C1=N/O |
| InChI | InChI=1S/C19H11F3N2O/c20-19(21,22)14-8-6-13(7-9-14)15-10-16(12-4-2-1-3-5-12)18(24-25)17(15)11-23/h1-10,25H/b24-18- |
| InChIKey | JDYWABFHQVOIAL-MOHJPFBDSA-N |
| XLogP | 4.91 |
| TPSA | 56.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.30 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (5Z)-5-hydroxyimino-4-phenyl-2-[4-(trifluoromethyl)phenyl]cyclopenta-1,3-diene-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z)-5-hydroxyimino-4-phenyl-2-[4-(trifluoromethyl)phenyl]cyclopenta-1,3-diene-1-carbonitrile?
The IUPAC name of (5Z)-5-hydroxyimino-4-phenyl-2-[4-(trifluoromethyl)phenyl]cyclopenta-1,3-diene-1-carbonitrile (CID 155144336) is (5Z)-5-hydroxyimino-4-phenyl-2-[4-(trifluoromethyl)phenyl]cyclopenta-1,3-diene-1-carbonitrile.
What is the SMILES notation for (5Z)-5-hydroxyimino-4-phenyl-2-[4-(trifluoromethyl)phenyl]cyclopenta-1,3-diene-1-carbonitrile?
The canonical SMILES for (5Z)-5-hydroxyimino-4-phenyl-2-[4-(trifluoromethyl)phenyl]cyclopenta-1,3-diene-1-carbonitrile is N#CC1=C(c2ccc(C(F)(F)F)cc2)C=C(c2ccccc2)/C1=N/O.
What is the InChIKey of (5Z)-5-hydroxyimino-4-phenyl-2-[4-(trifluoromethyl)phenyl]cyclopenta-1,3-diene-1-carbonitrile?
The InChIKey is JDYWABFHQVOIAL-MOHJPFBDSA-N. The full InChI is InChI=1S/C19H11F3N2O/c20-19(21,22)14-8-6-13(7-9-14)15-10-16(12-4-2-1-3-5-12)18(24-25)17(15)11-23/h1-10,25H/b24-18-.
What are the key properties of (5Z)-5-hydroxyimino-4-phenyl-2-[4-(trifluoromethyl)phenyl]cyclopenta-1,3-diene-1-carbonitrile?
(5Z)-5-hydroxyimino-4-phenyl-2-[4-(trifluoromethyl)phenyl]cyclopenta-1,3-diene-1-carbonitrile has a molecular weight of 340.30 g/mol, XLogP of 4.91, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z)-5-hydroxyimino-4-phenyl-2-[4-(trifluoromethyl)phenyl]cyclopenta-1,3-diene-1-carbonitrile is sourced from PubChem (CID 155144336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).