C30H26N12S2 — CID 155144415
2-N-[2-[[2-[[4-amino-6-(3-aminophenyl)-1,3,5-triazin-2-yl]amino]phenyl]disulfanyl]phenyl]-6-(3-aminophenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 155144415) has the molecular formula C30H26N12S2 and a molecular weight of 618.76 g/mol. Its IUPAC name is 2-N-[2-[[2-[[4-amino-6-(3-aminophenyl)-1,3,5-triazin-2-yl]amino]phenyl]disulfanyl]phenyl]-6-(3-aminophenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[2-[[2-[[4-amino-6-(3-aminophenyl)-1,3,5-triazin-2-yl]amino]phenyl]disulfanyl]phenyl]-6-(3-aminophenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 155144415 |
| Molecular Formula | C30H26N12S2 |
| Molecular Weight | 618.76 g/mol |
| Exact Mass | 618.18 |
| IUPAC Name | 2-N-[2-[[2-[[4-amino-6-(3-aminophenyl)-1,3,5-triazin-2-yl]amino]phenyl]disulfanyl]phenyl]-6-(3-aminophenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1cccc(-c2nc(N)nc(Nc3ccccc3SSc3ccccc3Nc3nc(N)nc(-c4cccc(N)c4)n3)n2)c1 |
| InChI | InChI=1S/C30H26N12S2/c31-19-9-5-7-17(15-19)25-37-27(33)41-29(39-25)35-21-11-1-3-13-23(21)43-44-24-14-4-2-12-22(24)36-30-40-26(38-28(34)42-30)18-8-6-10-20(32)16-18/h1-16H,31-32H2,(H3,33,35,37,39,41)(H3,34,36,38,40,42) |
| InChIKey | IFLAOCNAKMYEFS-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 205.48 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.76 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|