C28H22N12S2 — CID 155144500
2-N-[2-[[2-[(4-amino-6-pyridin-3-yl-1,3,5-triazin-2-yl)amino]phenyl]disulfanyl]phenyl]-6-pyridin-3-yl-1,3,5-triazine-2,4-diamine (PubChem CID 155144500) has the molecular formula C28H22N12S2 and a molecular weight of 590.70 g/mol. Its IUPAC name is 2-N-[2-[[2-[(4-amino-6-pyridin-3-yl-1,3,5-triazin-2-yl)amino]phenyl]disulfanyl]phenyl]-6-pyridin-3-yl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[2-[[2-[(4-amino-6-pyridin-3-yl-1,3,5-triazin-2-yl)amino]phenyl]disulfanyl]phenyl]-6-pyridin-3-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 155144500 |
| Molecular Formula | C28H22N12S2 |
| Molecular Weight | 590.70 g/mol |
| Exact Mass | 590.15 |
| IUPAC Name | 2-N-[2-[[2-[(4-amino-6-pyridin-3-yl-1,3,5-triazin-2-yl)amino]phenyl]disulfanyl]phenyl]-6-pyridin-3-yl-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(Nc2ccccc2SSc2ccccc2Nc2nc(N)nc(-c3cccnc3)n2)nc(-c2cccnc2)n1 |
| InChI | InChI=1S/C28H22N12S2/c29-25-35-23(17-7-5-13-31-15-17)37-27(39-25)33-19-9-1-3-11-21(19)41-42-22-12-4-2-10-20(22)34-28-38-24(36-26(30)40-28)18-8-6-14-32-16-18/h1-16H,(H3,29,33,35,37,39)(H3,30,34,36,38,40) |
| InChIKey | ITRZYEBSPUWJNL-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 179.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.70 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|