About N'-[(E)-N'-(1,3-benzothiazol-2-yl)carbamimidoyl]-3-chlorobenzenecarboximidamide
N'-[(E)-N'-(1,3-benzothiazol-2-yl)carbamimidoyl]-3-chlorobenzenecarboximidamide (PubChem CID 155144515) has the molecular formula C15H12ClN5S
and a molecular weight of 329.82 g/mol. Its IUPAC name is N'-[(E)-N'-(1,3-benzothiazol-2-yl)carbamimidoyl]-3-chlorobenzenecarboximidamide.
Molecular Properties
| Compound Name | N'-[(E)-N'-(1,3-benzothiazol-2-yl)carbamimidoyl]-3-chlorobenzenecarboximidamide |
| PubChem CID | 155144515 |
| Molecular Formula | C15H12ClN5S |
| Molecular Weight | 329.82 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | N'-[(E)-N'-(1,3-benzothiazol-2-yl)carbamimidoyl]-3-chlorobenzenecarboximidamide |
| SMILES | N/C(=N\C(N)=N\c1nc2ccccc2s1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H12ClN5S/c16-10-5-3-4-9(8-10)13(17)20-14(18)21-15-19-11-6-1-2-7-12(11)22-15/h1-8H,(H4,17,18,19,20,21) |
| InChIKey | YPUCEYBCRIOIFJ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 89.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.82 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-[(E)-N'-(1,3-benzothiazol-2-yl)carbamimidoyl]-3-chlorobenzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(E)-N'-(1,3-benzothiazol-2-yl)carbamimidoyl]-3-chlorobenzenecarboximidamide?
The IUPAC name of N'-[(E)-N'-(1,3-benzothiazol-2-yl)carbamimidoyl]-3-chlorobenzenecarboximidamide (CID 155144515) is N'-[(E)-N'-(1,3-benzothiazol-2-yl)carbamimidoyl]-3-chlorobenzenecarboximidamide.
What is the SMILES notation for N'-[(E)-N'-(1,3-benzothiazol-2-yl)carbamimidoyl]-3-chlorobenzenecarboximidamide?
The canonical SMILES for N'-[(E)-N'-(1,3-benzothiazol-2-yl)carbamimidoyl]-3-chlorobenzenecarboximidamide is N/C(=N\C(N)=N\c1nc2ccccc2s1)c1cccc(Cl)c1.
What is the InChIKey of N'-[(E)-N'-(1,3-benzothiazol-2-yl)carbamimidoyl]-3-chlorobenzenecarboximidamide?
The InChIKey is YPUCEYBCRIOIFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12ClN5S/c16-10-5-3-4-9(8-10)13(17)20-14(18)21-15-19-11-6-1-2-7-12(11)22-15/h1-8H,(H4,17,18,19,20,21).
What are the key properties of N'-[(E)-N'-(1,3-benzothiazol-2-yl)carbamimidoyl]-3-chlorobenzenecarboximidamide?
N'-[(E)-N'-(1,3-benzothiazol-2-yl)carbamimidoyl]-3-chlorobenzenecarboximidamide has a molecular weight of 329.82 g/mol, XLogP of 3.30, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(E)-N'-(1,3-benzothiazol-2-yl)carbamimidoyl]-3-chlorobenzenecarboximidamide is sourced from PubChem (CID 155144515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).