C25H24Cl2N4O4S — CID 155145108
N-[4-[[4-[2-[3-chloro-4-(2-chloroethoxy)-5-cyanophenyl]propan-2-yl]phenoxy]methyl]pyrimidin-2-yl]ethenesulfonamide (PubChem CID 155145108) has the molecular formula C25H24Cl2N4O4S and a molecular weight of 547.46 g/mol. Its IUPAC name is N-[4-[[4-[2-[3-chloro-4-(2-chloroethoxy)-5-cyanophenyl]propan-2-yl]phenoxy]methyl]pyrimidin-2-yl]ethenesulfonamide.
| Compound Name | N-[4-[[4-[2-[3-chloro-4-(2-chloroethoxy)-5-cyanophenyl]propan-2-yl]phenoxy]methyl]pyrimidin-2-yl]ethenesulfonamide |
|---|---|
| PubChem CID | 155145108 |
| Molecular Formula | C25H24Cl2N4O4S |
| Molecular Weight | 547.46 g/mol |
| Exact Mass | 546.09 |
| IUPAC Name | N-[4-[[4-[2-[3-chloro-4-(2-chloroethoxy)-5-cyanophenyl]propan-2-yl]phenoxy]methyl]pyrimidin-2-yl]ethenesulfonamide |
| SMILES | C=CS(=O)(=O)Nc1nccc(COc2ccc(C(C)(C)c3cc(Cl)c(OCCCl)c(C#N)c3)cc2)n1 |
| InChI | InChI=1S/C25H24Cl2N4O4S/c1-4-36(32,33)31-24-29-11-9-20(30-24)16-35-21-7-5-18(6-8-21)25(2,3)19-13-17(15-28)23(22(27)14-19)34-12-10-26/h4-9,11,13-14H,1,10,12,16H2,2-3H3,(H,29,30,31) |
| InChIKey | IFTWTYJQOALTJX-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 114.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.46 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|