C25H31N3O6 — CID 155145518
benzyl 4-[methoxy(methyl)carbamoyl]-3-(phenylmethoxycarbonylamino)azepane-1-carboxylate (PubChem CID 155145518) has the molecular formula C25H31N3O6 and a molecular weight of 469.54 g/mol. Its IUPAC name is benzyl 4-[methoxy(methyl)carbamoyl]-3-(phenylmethoxycarbonylamino)azepane-1-carboxylate.
| Compound Name | benzyl 4-[methoxy(methyl)carbamoyl]-3-(phenylmethoxycarbonylamino)azepane-1-carboxylate |
|---|---|
| PubChem CID | 155145518 |
| Molecular Formula | C25H31N3O6 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.22 |
| IUPAC Name | benzyl 4-[methoxy(methyl)carbamoyl]-3-(phenylmethoxycarbonylamino)azepane-1-carboxylate |
| SMILES | CON(C)C(=O)C1CCCN(C(=O)OCc2ccccc2)CC1NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H31N3O6/c1-27(32-2)23(29)21-14-9-15-28(25(31)34-18-20-12-7-4-8-13-20)16-22(21)26-24(30)33-17-19-10-5-3-6-11-19/h3-8,10-13,21-22H,9,14-18H2,1-2H3,(H,26,30) |
| InChIKey | ZEAGUZKMYMVFNB-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|