About 3-azido-5-hexyldioxolane
3-azido-5-hexyldioxolane (PubChem CID 155146191) has the molecular formula C9H17N3O2
and a molecular weight of 199.25 g/mol. Its IUPAC name is 3-azido-5-hexyldioxolane.
Molecular Properties
| Compound Name | 3-azido-5-hexyldioxolane |
| PubChem CID | 155146191 |
| Molecular Formula | C9H17N3O2 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.13 |
| IUPAC Name | 3-azido-5-hexyldioxolane |
| SMILES | CCCCCCC1CC(N=[N+]=[N-])OO1 |
| InChI | InChI=1S/C9H17N3O2/c1-2-3-4-5-6-8-7-9(11-12-10)14-13-8/h8-9H,2-7H2,1H3 |
| InChIKey | YDEPDAHMJTUUMK-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 67.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 3-azido-5-hexyldioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-azido-5-hexyldioxolane?
The IUPAC name of 3-azido-5-hexyldioxolane (CID 155146191) is 3-azido-5-hexyldioxolane.
What is the SMILES notation for 3-azido-5-hexyldioxolane?
The canonical SMILES for 3-azido-5-hexyldioxolane is CCCCCCC1CC(N=[N+]=[N-])OO1.
What is the InChIKey of 3-azido-5-hexyldioxolane?
The InChIKey is YDEPDAHMJTUUMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3O2/c1-2-3-4-5-6-8-7-9(11-12-10)14-13-8/h8-9H,2-7H2,1H3.
What are the key properties of 3-azido-5-hexyldioxolane?
3-azido-5-hexyldioxolane has a molecular weight of 199.25 g/mol, XLogP of 3.31, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-azido-5-hexyldioxolane is sourced from PubChem (CID 155146191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).