C12H22Cl2N2O2 — CID 155146596
tert-butyl 4-(1,3-dichloropropan-2-yl)piperazine-1-carboxylate (PubChem CID 155146596) has the molecular formula C12H22Cl2N2O2 and a molecular weight of 297.23 g/mol. Its IUPAC name is tert-butyl 4-(1,3-dichloropropan-2-yl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(1,3-dichloropropan-2-yl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 155146596 |
| Molecular Formula | C12H22Cl2N2O2 |
| Molecular Weight | 297.23 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | tert-butyl 4-(1,3-dichloropropan-2-yl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(CCl)CCl)CC1 |
| InChI | InChI=1S/C12H22Cl2N2O2/c1-12(2,3)18-11(17)16-6-4-15(5-7-16)10(8-13)9-14/h10H,4-9H2,1-3H3 |
| InChIKey | CDLOUXBHADSECE-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.23 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|