About [1-[2-(3,5-ditert-butyl-4-methoxyphenyl)naphthalen-1-yl]naphthalen-2-yl]phosphane
[1-[2-(3,5-ditert-butyl-4-methoxyphenyl)naphthalen-1-yl]naphthalen-2-yl]phosphane (PubChem CID 155147385) has the molecular formula C35H37OP
and a molecular weight of 504.65 g/mol. Its IUPAC name is [1-[2-(3,5-ditert-butyl-4-methoxyphenyl)naphthalen-1-yl]naphthalen-2-yl]phosphane.
Molecular Properties
| Compound Name | [1-[2-(3,5-ditert-butyl-4-methoxyphenyl)naphthalen-1-yl]naphthalen-2-yl]phosphane |
| PubChem CID | 155147385 |
| Molecular Formula | C35H37OP |
| Molecular Weight | 504.65 g/mol |
| Exact Mass | 504.26 |
| IUPAC Name | [1-[2-(3,5-ditert-butyl-4-methoxyphenyl)naphthalen-1-yl]naphthalen-2-yl]phosphane |
| SMILES | COc1c(C(C)(C)C)cc(-c2ccc3ccccc3c2-c2c(P)ccc3ccccc23)cc1C(C)(C)C |
| InChI | InChI=1S/C35H37OP/c1-34(2,3)28-20-24(21-29(33(28)36-7)35(4,5)6)27-18-16-22-12-8-10-14-25(22)31(27)32-26-15-11-9-13-23(26)17-19-30(32)37/h8-21H,37H2,1-7H3 |
| InChIKey | JXGWHBIJTLOMRC-UHFFFAOYSA-N |
| XLogP | 9.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 504.65 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [1-[2-(3,5-ditert-butyl-4-methoxyphenyl)naphthalen-1-yl]naphthalen-2-yl]phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[2-(3,5-ditert-butyl-4-methoxyphenyl)naphthalen-1-yl]naphthalen-2-yl]phosphane?
The IUPAC name of [1-[2-(3,5-ditert-butyl-4-methoxyphenyl)naphthalen-1-yl]naphthalen-2-yl]phosphane (CID 155147385) is [1-[2-(3,5-ditert-butyl-4-methoxyphenyl)naphthalen-1-yl]naphthalen-2-yl]phosphane.
What is the SMILES notation for [1-[2-(3,5-ditert-butyl-4-methoxyphenyl)naphthalen-1-yl]naphthalen-2-yl]phosphane?
The canonical SMILES for [1-[2-(3,5-ditert-butyl-4-methoxyphenyl)naphthalen-1-yl]naphthalen-2-yl]phosphane is COc1c(C(C)(C)C)cc(-c2ccc3ccccc3c2-c2c(P)ccc3ccccc23)cc1C(C)(C)C.
What is the InChIKey of [1-[2-(3,5-ditert-butyl-4-methoxyphenyl)naphthalen-1-yl]naphthalen-2-yl]phosphane?
The InChIKey is JXGWHBIJTLOMRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C35H37OP/c1-34(2,3)28-20-24(21-29(33(28)36-7)35(4,5)6)27-18-16-22-12-8-10-14-25(22)31(27)32-26-15-11-9-13-23(26)17-19-30(32)37/h8-21H,37H2,1-7H3.
What are the key properties of [1-[2-(3,5-ditert-butyl-4-methoxyphenyl)naphthalen-1-yl]naphthalen-2-yl]phosphane?
[1-[2-(3,5-ditert-butyl-4-methoxyphenyl)naphthalen-1-yl]naphthalen-2-yl]phosphane has a molecular weight of 504.65 g/mol, XLogP of 9.43, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[2-(3,5-ditert-butyl-4-methoxyphenyl)naphthalen-1-yl]naphthalen-2-yl]phosphane is sourced from PubChem (CID 155147385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).