About 3-(2-aminophenyl)benzene-1,2-diamine;ethoxyethane
3-(2-aminophenyl)benzene-1,2-diamine;ethoxyethane (PubChem CID 155147484) has the molecular formula C16H23N3O
and a molecular weight of 273.38 g/mol. Its IUPAC name is 3-(2-aminophenyl)benzene-1,2-diamine;ethoxyethane.
Molecular Properties
| Compound Name | 3-(2-aminophenyl)benzene-1,2-diamine;ethoxyethane |
| PubChem CID | 155147484 |
| Molecular Formula | C16H23N3O |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | 3-(2-aminophenyl)benzene-1,2-diamine;ethoxyethane |
| SMILES | CCOCC.Nc1ccccc1-c1cccc(N)c1N |
| InChI | InChI=1S/C12H13N3.C4H10O/c13-10-6-2-1-4-8(10)9-5-3-7-11(14)12(9)15;1-3-5-4-2/h1-7H,13-15H2;3-4H2,1-2H3 |
| InChIKey | GZKMDBLBNBCLTM-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 87.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-aminophenyl)benzene-1,2-diamine;ethoxyethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-aminophenyl)benzene-1,2-diamine;ethoxyethane?
The IUPAC name of 3-(2-aminophenyl)benzene-1,2-diamine;ethoxyethane (CID 155147484) is 3-(2-aminophenyl)benzene-1,2-diamine;ethoxyethane.
What is the SMILES notation for 3-(2-aminophenyl)benzene-1,2-diamine;ethoxyethane?
The canonical SMILES for 3-(2-aminophenyl)benzene-1,2-diamine;ethoxyethane is CCOCC.Nc1ccccc1-c1cccc(N)c1N.
What is the InChIKey of 3-(2-aminophenyl)benzene-1,2-diamine;ethoxyethane?
The InChIKey is GZKMDBLBNBCLTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N3.C4H10O/c13-10-6-2-1-4-8(10)9-5-3-7-11(14)12(9)15;1-3-5-4-2/h1-7H,13-15H2;3-4H2,1-2H3.
What are the key properties of 3-(2-aminophenyl)benzene-1,2-diamine;ethoxyethane?
3-(2-aminophenyl)benzene-1,2-diamine;ethoxyethane has a molecular weight of 273.38 g/mol, XLogP of 3.14, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-aminophenyl)benzene-1,2-diamine;ethoxyethane is sourced from PubChem (CID 155147484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).