C35H47N3O11 — CID 155147781
tert-butyl 2-[4-[(3S)-4-amino-3-[3-[2-[2-[2-[2-(1,3-dioxoisoindol-2-yl)ethoxy]ethoxy]ethoxy]ethoxy]propanoylamino]-4-oxobutyl]phenoxy]acetate (PubChem CID 155147781) has the molecular formula C35H47N3O11 and a molecular weight of 685.77 g/mol. Its IUPAC name is tert-butyl 2-[4-[(3S)-4-amino-3-[3-[2-[2-[2-[2-(1,3-dioxoisoindol-2-yl)ethoxy]ethoxy]ethoxy]ethoxy]propanoylamino]-4-oxobutyl]phenoxy]acetate.
| Compound Name | tert-butyl 2-[4-[(3S)-4-amino-3-[3-[2-[2-[2-[2-(1,3-dioxoisoindol-2-yl)ethoxy]ethoxy]ethoxy]ethoxy]propanoylamino]-4-oxobutyl]phenoxy]acetate |
|---|---|
| PubChem CID | 155147781 |
| Molecular Formula | C35H47N3O11 |
| Molecular Weight | 685.77 g/mol |
| Exact Mass | 685.32 |
| IUPAC Name | tert-butyl 2-[4-[(3S)-4-amino-3-[3-[2-[2-[2-[2-(1,3-dioxoisoindol-2-yl)ethoxy]ethoxy]ethoxy]ethoxy]propanoylamino]-4-oxobutyl]phenoxy]acetate |
| SMILES | CC(C)(C)OC(=O)COc1ccc(CC[C@H](NC(=O)CCOCCOCCOCCOCCN2C(=O)c3ccccc3C2=O)C(N)=O)cc1 |
| InChI | InChI=1S/C35H47N3O11/c1-35(2,3)49-31(40)24-48-26-11-8-25(9-12-26)10-13-29(32(36)41)37-30(39)14-16-44-18-20-46-22-23-47-21-19-45-17-15-38-33(42)27-6-4-5-7-28(27)34(38)43/h4-9,11-12,29H,10,13-24H2,1-3H3,(H2,36,41)(H,37,39)/t29-/m0/s1 |
| InChIKey | DXPXKJIMEBHIFP-LJAQVGFWSA-N |
| XLogP | 2.06 |
| TPSA | 182.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.77 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|