C21H30N4O2 — CID 155147800
N-[(1R,5R)-3-butoxy-8-bicyclo[3.2.1]octanyl]-2,4-dimethylimidazo[1,5-a]pyrimidine-8-carboxamide (PubChem CID 155147800) has the molecular formula C21H30N4O2 and a molecular weight of 370.50 g/mol. Its IUPAC name is N-[(1R,5R)-3-butoxy-8-bicyclo[3.2.1]octanyl]-2,4-dimethylimidazo[1,5-a]pyrimidine-8-carboxamide.
| Compound Name | N-[(1R,5R)-3-butoxy-8-bicyclo[3.2.1]octanyl]-2,4-dimethylimidazo[1,5-a]pyrimidine-8-carboxamide |
|---|---|
| PubChem CID | 155147800 |
| Molecular Formula | C21H30N4O2 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | N-[(1R,5R)-3-butoxy-8-bicyclo[3.2.1]octanyl]-2,4-dimethylimidazo[1,5-a]pyrimidine-8-carboxamide |
| SMILES | CCCCOC1C[C@H]2CC[C@H](C1)C2NC(=O)c1ncn2c(C)cc(C)nc12 |
| InChI | InChI=1S/C21H30N4O2/c1-4-5-8-27-17-10-15-6-7-16(11-17)18(15)24-21(26)19-20-23-13(2)9-14(3)25(20)12-22-19/h9,12,15-18H,4-8,10-11H2,1-3H3,(H,24,26)/t15-,16-,17?,18?/m1/s1 |
| InChIKey | JFMLCKFFZFLWJR-MRLCAUJQSA-N |
| XLogP | 3.45 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|