About 2,4-ditert-butyl-1,2-dihydropyridine
2,4-ditert-butyl-1,2-dihydropyridine (PubChem CID 155147884) has the molecular formula C13H23N
and a molecular weight of 193.33 g/mol. Its IUPAC name is 2,4-ditert-butyl-1,2-dihydropyridine.
Molecular Properties
| Compound Name | 2,4-ditert-butyl-1,2-dihydropyridine |
| PubChem CID | 155147884 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | 2,4-ditert-butyl-1,2-dihydropyridine |
| SMILES | CC(C)(C)C1=CC(C(C)(C)C)NC=C1 |
| InChI | InChI=1S/C13H23N/c1-12(2,3)10-7-8-14-11(9-10)13(4,5)6/h7-9,11,14H,1-6H3 |
| InChIKey | IISPGVKZQWKHNP-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,4-ditert-butyl-1,2-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-ditert-butyl-1,2-dihydropyridine?
The IUPAC name of 2,4-ditert-butyl-1,2-dihydropyridine (CID 155147884) is 2,4-ditert-butyl-1,2-dihydropyridine.
What is the SMILES notation for 2,4-ditert-butyl-1,2-dihydropyridine?
The canonical SMILES for 2,4-ditert-butyl-1,2-dihydropyridine is CC(C)(C)C1=CC(C(C)(C)C)NC=C1.
What is the InChIKey of 2,4-ditert-butyl-1,2-dihydropyridine?
The InChIKey is IISPGVKZQWKHNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N/c1-12(2,3)10-7-8-14-11(9-10)13(4,5)6/h7-9,11,14H,1-6H3.
What are the key properties of 2,4-ditert-butyl-1,2-dihydropyridine?
2,4-ditert-butyl-1,2-dihydropyridine has a molecular weight of 193.33 g/mol, XLogP of 3.49, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-ditert-butyl-1,2-dihydropyridine is sourced from PubChem (CID 155147884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).