C31H35N5O4S2 — CID 155148062
3-(2-methoxyethylamino)-N-[3-[5-[4-(morpholine-4-carbonyl)phenyl]-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]propanamide (PubChem CID 155148062) has the molecular formula C31H35N5O4S2 and a molecular weight of 605.79 g/mol. Its IUPAC name is 3-(2-methoxyethylamino)-N-[3-[5-[4-(morpholine-4-carbonyl)phenyl]-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]propanamide.
| Compound Name | 3-(2-methoxyethylamino)-N-[3-[5-[4-(morpholine-4-carbonyl)phenyl]-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]propanamide |
|---|---|
| PubChem CID | 155148062 |
| Molecular Formula | C31H35N5O4S2 |
| Molecular Weight | 605.79 g/mol |
| Exact Mass | 605.21 |
| IUPAC Name | 3-(2-methoxyethylamino)-N-[3-[5-[4-(morpholine-4-carbonyl)phenyl]-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]propanamide |
| SMILES | COCCNCCC(=O)Nc1sc2c(c1-c1nc3cc(-c4ccc(C(=O)N5CCOCC5)cc4)ccc3s1)CCNC2 |
| InChI | InChI=1S/C31H35N5O4S2/c1-39-15-12-32-11-9-27(37)35-30-28(23-8-10-33-19-26(23)42-30)29-34-24-18-22(6-7-25(24)41-29)20-2-4-21(5-3-20)31(38)36-13-16-40-17-14-36/h2-7,18,32-33H,8-17,19H2,1H3,(H,35,37) |
| InChIKey | FVVILKQMYNDBRB-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 104.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.79 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|