C22H27FN4O2S2 — CID 155148066
N-[(5R,7S)-3-(5-fluoro-1,3-benzothiazol-2-yl)-5,7-dimethyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]-3-(2-methoxyethylamino)propanamide (PubChem CID 155148066) has the molecular formula C22H27FN4O2S2 and a molecular weight of 462.62 g/mol. Its IUPAC name is N-[(5R,7S)-3-(5-fluoro-1,3-benzothiazol-2-yl)-5,7-dimethyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]-3-(2-methoxyethylamino)propanamide.
| Compound Name | N-[(5R,7S)-3-(5-fluoro-1,3-benzothiazol-2-yl)-5,7-dimethyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]-3-(2-methoxyethylamino)propanamide |
|---|---|
| PubChem CID | 155148066 |
| Molecular Formula | C22H27FN4O2S2 |
| Molecular Weight | 462.62 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | N-[(5R,7S)-3-(5-fluoro-1,3-benzothiazol-2-yl)-5,7-dimethyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]-3-(2-methoxyethylamino)propanamide |
| SMILES | COCCNCCC(=O)Nc1sc2c(c1-c1nc3cc(F)ccc3s1)C[C@@H](C)N[C@H]2C |
| InChI | InChI=1S/C22H27FN4O2S2/c1-12-10-15-19(21-26-16-11-14(23)4-5-17(16)30-21)22(31-20(15)13(2)25-12)27-18(28)6-7-24-8-9-29-3/h4-5,11-13,24-25H,6-10H2,1-3H3,(H,27,28)/t12-,13+/m1/s1 |
| InChIKey | BGRFOYDBKLQJDW-OLZOCXBDSA-N |
| XLogP | 4.32 |
| TPSA | 75.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.62 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|