C22H25F3N4O2S2 — CID 155148072
3-(2-methoxyethylamino)-N-[(5R)-5-methyl-3-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]propanamide (PubChem CID 155148072) has the molecular formula C22H25F3N4O2S2 and a molecular weight of 498.60 g/mol. Its IUPAC name is 3-(2-methoxyethylamino)-N-[(5R)-5-methyl-3-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]propanamide.
| Compound Name | 3-(2-methoxyethylamino)-N-[(5R)-5-methyl-3-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]propanamide |
|---|---|
| PubChem CID | 155148072 |
| Molecular Formula | C22H25F3N4O2S2 |
| Molecular Weight | 498.60 g/mol |
| Exact Mass | 498.14 |
| IUPAC Name | 3-(2-methoxyethylamino)-N-[(5R)-5-methyl-3-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]propanamide |
| SMILES | COCCNCCC(=O)Nc1sc2c(c1-c1nc3cc(C(F)(F)F)ccc3s1)C[C@@H](C)NC2 |
| InChI | InChI=1S/C22H25F3N4O2S2/c1-12-9-14-17(11-27-12)33-21(29-18(30)5-6-26-7-8-31-2)19(14)20-28-15-10-13(22(23,24)25)3-4-16(15)32-20/h3-4,10,12,26-27H,5-9,11H2,1-2H3,(H,29,30)/t12-/m1/s1 |
| InChIKey | URHHMTVFLPPDJG-GFCCVEGCSA-N |
| XLogP | 4.64 |
| TPSA | 75.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.60 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|