C25H31N5O2S2 — CID 155148077
3-(2-methoxyethylamino)-N-[3-[5-(1,2,3,6-tetrahydropyridin-4-yl)-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]propanamide (PubChem CID 155148077) has the molecular formula C25H31N5O2S2 and a molecular weight of 497.69 g/mol. Its IUPAC name is 3-(2-methoxyethylamino)-N-[3-[5-(1,2,3,6-tetrahydropyridin-4-yl)-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]propanamide.
| Compound Name | 3-(2-methoxyethylamino)-N-[3-[5-(1,2,3,6-tetrahydropyridin-4-yl)-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]propanamide |
|---|---|
| PubChem CID | 155148077 |
| Molecular Formula | C25H31N5O2S2 |
| Molecular Weight | 497.69 g/mol |
| Exact Mass | 497.19 |
| IUPAC Name | 3-(2-methoxyethylamino)-N-[3-[5-(1,2,3,6-tetrahydropyridin-4-yl)-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]propanamide |
| SMILES | COCCNCCC(=O)Nc1sc2c(c1-c1nc3cc(C4=CCNCC4)ccc3s1)CCNC2 |
| InChI | InChI=1S/C25H31N5O2S2/c1-32-13-12-27-11-7-22(31)30-25-23(18-6-10-28-15-21(18)34-25)24-29-19-14-17(2-3-20(19)33-24)16-4-8-26-9-5-16/h2-4,14,26-28H,5-13,15H2,1H3,(H,30,31) |
| InChIKey | TWORYTIOZPKSGT-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 87.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.69 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|