C25H28N6O2S2 — CID 155148105
N-[3-[5-(2-amino-4-pyridinyl)-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]-3-(2-methoxyethylamino)propanamide (PubChem CID 155148105) has the molecular formula C25H28N6O2S2 and a molecular weight of 508.67 g/mol. Its IUPAC name is N-[3-[5-(2-amino-4-pyridinyl)-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]-3-(2-methoxyethylamino)propanamide.
| Compound Name | N-[3-[5-(2-amino-4-pyridinyl)-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]-3-(2-methoxyethylamino)propanamide |
|---|---|
| PubChem CID | 155148105 |
| Molecular Formula | C25H28N6O2S2 |
| Molecular Weight | 508.67 g/mol |
| Exact Mass | 508.17 |
| IUPAC Name | N-[3-[5-(2-amino-4-pyridinyl)-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]-3-(2-methoxyethylamino)propanamide |
| SMILES | COCCNCCC(=O)Nc1sc2c(c1-c1nc3cc(-c4ccnc(N)c4)ccc3s1)CCNC2 |
| InChI | InChI=1S/C25H28N6O2S2/c1-33-11-10-27-8-6-22(32)31-25-23(17-5-7-28-14-20(17)35-25)24-30-18-12-15(2-3-19(18)34-24)16-4-9-29-21(26)13-16/h2-4,9,12-13,27-28H,5-8,10-11,14H2,1H3,(H2,26,29)(H,31,32) |
| InChIKey | IREQBONYPXDKPZ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 114.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.67 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|