C25H28N6O3S2 — CID 155148110
3-(2-methoxyethylamino)-N-[3-[5-(2-methoxypyrimidin-5-yl)-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]propanamide (PubChem CID 155148110) has the molecular formula C25H28N6O3S2 and a molecular weight of 524.67 g/mol. Its IUPAC name is 3-(2-methoxyethylamino)-N-[3-[5-(2-methoxypyrimidin-5-yl)-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]propanamide.
| Compound Name | 3-(2-methoxyethylamino)-N-[3-[5-(2-methoxypyrimidin-5-yl)-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]propanamide |
|---|---|
| PubChem CID | 155148110 |
| Molecular Formula | C25H28N6O3S2 |
| Molecular Weight | 524.67 g/mol |
| Exact Mass | 524.17 |
| IUPAC Name | 3-(2-methoxyethylamino)-N-[3-[5-(2-methoxypyrimidin-5-yl)-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]propanamide |
| SMILES | COCCNCCC(=O)Nc1sc2c(c1-c1nc3cc(-c4cnc(OC)nc4)ccc3s1)CCNC2 |
| InChI | InChI=1S/C25H28N6O3S2/c1-33-10-9-26-8-6-21(32)31-24-22(17-5-7-27-14-20(17)36-24)23-30-18-11-15(3-4-19(18)35-23)16-12-28-25(34-2)29-13-16/h3-4,11-13,26-27H,5-10,14H2,1-2H3,(H,31,32) |
| InChIKey | AWAXFPJUFDNPAI-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 110.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.67 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|