C30H35FN6O5S2 — CID 155148192
N-[(2,4-dimethoxyphenyl)methyl]-4-[(2S,4R)-4-(fluoromethyl)-2-(2-methylpyrazol-3-yl)piperidin-1-yl]-N-(1,2,4-thiadiazol-5-yl)-3,4-dihydro-2H-chromene-7-sulfonamide (PubChem CID 155148192) has the molecular formula C30H35FN6O5S2 and a molecular weight of 642.78 g/mol. Its IUPAC name is N-[(2,4-dimethoxyphenyl)methyl]-4-[(2S,4R)-4-(fluoromethyl)-2-(2-methylpyrazol-3-yl)piperidin-1-yl]-N-(1,2,4-thiadiazol-5-yl)-3,4-dihydro-2H-chromene-7-sulfonamide.
| Compound Name | N-[(2,4-dimethoxyphenyl)methyl]-4-[(2S,4R)-4-(fluoromethyl)-2-(2-methylpyrazol-3-yl)piperidin-1-yl]-N-(1,2,4-thiadiazol-5-yl)-3,4-dihydro-2H-chromene-7-sulfonamide |
|---|---|
| PubChem CID | 155148192 |
| Molecular Formula | C30H35FN6O5S2 |
| Molecular Weight | 642.78 g/mol |
| Exact Mass | 642.21 |
| IUPAC Name | N-[(2,4-dimethoxyphenyl)methyl]-4-[(2S,4R)-4-(fluoromethyl)-2-(2-methylpyrazol-3-yl)piperidin-1-yl]-N-(1,2,4-thiadiazol-5-yl)-3,4-dihydro-2H-chromene-7-sulfonamide |
| SMILES | COc1ccc(CN(c2ncns2)S(=O)(=O)c2ccc3c(c2)OCCC3N2CC[C@@H](CF)C[C@H]2c2ccnn2C)c(OC)c1 |
| InChI | InChI=1S/C30H35FN6O5S2/c1-35-26(8-11-33-35)27-14-20(17-31)9-12-36(27)25-10-13-42-29-16-23(6-7-24(25)29)44(38,39)37(30-32-19-34-43-30)18-21-4-5-22(40-2)15-28(21)41-3/h4-8,11,15-16,19-20,25,27H,9-10,12-14,17-18H2,1-3H3/t20-,25?,27+/m1/s1 |
| InChIKey | HXHVYPKYLPXUAY-JPVZYGRTSA-N |
| XLogP | 4.93 |
| TPSA | 111.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.78 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |