C12H19NO2 — CID 155148330
[(1S,4Z,8R,9R)-4-methyl-9-bicyclo[6.1.0]non-4-enyl]methyl carbamate (PubChem CID 155148330) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is [(1S,4Z,8R,9R)-4-methyl-9-bicyclo[6.1.0]non-4-enyl]methyl carbamate.
| Compound Name | [(1S,4Z,8R,9R)-4-methyl-9-bicyclo[6.1.0]non-4-enyl]methyl carbamate |
|---|---|
| PubChem CID | 155148330 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | [(1S,4Z,8R,9R)-4-methyl-9-bicyclo[6.1.0]non-4-enyl]methyl carbamate |
| SMILES | C/C1=C/CC[C@@H]2[C@H](CC1)[C@@H]2COC(N)=O |
| InChI | InChI=1S/C12H19NO2/c1-8-3-2-4-9-10(6-5-8)11(9)7-15-12(13)14/h3,9-11H,2,4-7H2,1H3,(H2,13,14)/b8-3-/t9-,10+,11-/m1/s1 |
| InChIKey | SDRWOCSKOIJTQO-PGJBYGDZSA-N |
| XLogP | 2.46 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|