C25H44N6O5S — CID 155148460
6-[(3aS,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-[2-[2-[2-(4-butan-2-yltriazol-1-yl)ethoxy]ethoxy]ethoxy]ethyl]hexanamide (PubChem CID 155148460) has the molecular formula C25H44N6O5S and a molecular weight of 540.73 g/mol. Its IUPAC name is 6-[(3aS,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-[2-[2-[2-(4-butan-2-yltriazol-1-yl)ethoxy]ethoxy]ethoxy]ethyl]hexanamide.
| Compound Name | 6-[(3aS,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-[2-[2-[2-(4-butan-2-yltriazol-1-yl)ethoxy]ethoxy]ethoxy]ethyl]hexanamide |
|---|---|
| PubChem CID | 155148460 |
| Molecular Formula | C25H44N6O5S |
| Molecular Weight | 540.73 g/mol |
| Exact Mass | 540.31 |
| IUPAC Name | 6-[(3aS,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-[2-[2-[2-(4-butan-2-yltriazol-1-yl)ethoxy]ethoxy]ethoxy]ethyl]hexanamide |
| SMILES | CCC(C)c1cn(CCOCCOCCOCCNC(=O)CCCCCC2SC[C@@H]3NC(=O)N[C@H]23)nn1 |
| InChI | InChI=1S/C25H44N6O5S/c1-3-19(2)20-17-31(30-29-20)10-12-35-14-16-36-15-13-34-11-9-26-23(32)8-6-4-5-7-22-24-21(18-37-22)27-25(33)28-24/h17,19,21-22,24H,3-16,18H2,1-2H3,(H,26,32)(H2,27,28,33)/t19?,21-,22?,24-/m0/s1 |
| InChIKey | UNMAWSZFLXIGHT-DOHOZAFYSA-N |
| XLogP | 2.07 |
| TPSA | 128.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.73 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|