C27H38N2 — CID 155148848
1-[(1S)-4-cyclohexa-1,3-dien-1-ylcyclohex-3-en-1-yl]-N'-[1-(4-cyclohexa-1,5-dien-1-ylcyclohexen-1-yl)ethyl]methanediamine (PubChem CID 155148848) has the molecular formula C27H38N2 and a molecular weight of 390.62 g/mol. Its IUPAC name is 1-[(1S)-4-cyclohexa-1,3-dien-1-ylcyclohex-3-en-1-yl]-N'-[1-(4-cyclohexa-1,5-dien-1-ylcyclohexen-1-yl)ethyl]methanediamine.
| Compound Name | 1-[(1S)-4-cyclohexa-1,3-dien-1-ylcyclohex-3-en-1-yl]-N'-[1-(4-cyclohexa-1,5-dien-1-ylcyclohexen-1-yl)ethyl]methanediamine |
|---|---|
| PubChem CID | 155148848 |
| Molecular Formula | C27H38N2 |
| Molecular Weight | 390.62 g/mol |
| Exact Mass | 390.30 |
| IUPAC Name | 1-[(1S)-4-cyclohexa-1,3-dien-1-ylcyclohex-3-en-1-yl]-N'-[1-(4-cyclohexa-1,5-dien-1-ylcyclohexen-1-yl)ethyl]methanediamine |
| SMILES | CC(NC(N)[C@@H]1CC=C(C2=CC=CCC2)CC1)C1=CCC(C2=CCCC=C2)CC1 |
| InChI | InChI=1S/C27H38N2/c1-20(21-12-14-24(15-13-21)22-8-4-2-5-9-22)29-27(28)26-18-16-25(17-19-26)23-10-6-3-7-11-23/h3-4,6,8-10,12,16,20,24,26-27,29H,2,5,7,11,13-15,17-19,28H2,1H3/t20?,24?,26-,27?/m1/s1 |
| InChIKey | DYPDWDKDNFRKOC-NQDGXPRKSA-N |
| XLogP | 6.26 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.62 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|