About 3-[3-(2-aminoethyl)cyclohexa-1,3-dien-1-yl]-4,5-dihydro-1H-pyridazin-6-one
3-[3-(2-aminoethyl)cyclohexa-1,3-dien-1-yl]-4,5-dihydro-1H-pyridazin-6-one (PubChem CID 155148873) has the molecular formula C12H17N3O
and a molecular weight of 219.29 g/mol. Its IUPAC name is 3-[3-(2-aminoethyl)cyclohexa-1,3-dien-1-yl]-4,5-dihydro-1H-pyridazin-6-one.
Molecular Properties
| Compound Name | 3-[3-(2-aminoethyl)cyclohexa-1,3-dien-1-yl]-4,5-dihydro-1H-pyridazin-6-one |
| PubChem CID | 155148873 |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | 3-[3-(2-aminoethyl)cyclohexa-1,3-dien-1-yl]-4,5-dihydro-1H-pyridazin-6-one |
| SMILES | NCCC1=CCCC(C2=NNC(=O)CC2)=C1 |
| InChI | InChI=1S/C12H17N3O/c13-7-6-9-2-1-3-10(8-9)11-4-5-12(16)15-14-11/h2,8H,1,3-7,13H2,(H,15,16) |
| InChIKey | SHFQOICQWKUQQC-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[3-(2-aminoethyl)cyclohexa-1,3-dien-1-yl]-4,5-dihydro-1H-pyridazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(2-aminoethyl)cyclohexa-1,3-dien-1-yl]-4,5-dihydro-1H-pyridazin-6-one?
The IUPAC name of 3-[3-(2-aminoethyl)cyclohexa-1,3-dien-1-yl]-4,5-dihydro-1H-pyridazin-6-one (CID 155148873) is 3-[3-(2-aminoethyl)cyclohexa-1,3-dien-1-yl]-4,5-dihydro-1H-pyridazin-6-one.
What is the SMILES notation for 3-[3-(2-aminoethyl)cyclohexa-1,3-dien-1-yl]-4,5-dihydro-1H-pyridazin-6-one?
The canonical SMILES for 3-[3-(2-aminoethyl)cyclohexa-1,3-dien-1-yl]-4,5-dihydro-1H-pyridazin-6-one is NCCC1=CCCC(C2=NNC(=O)CC2)=C1.
What is the InChIKey of 3-[3-(2-aminoethyl)cyclohexa-1,3-dien-1-yl]-4,5-dihydro-1H-pyridazin-6-one?
The InChIKey is SHFQOICQWKUQQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O/c13-7-6-9-2-1-3-10(8-9)11-4-5-12(16)15-14-11/h2,8H,1,3-7,13H2,(H,15,16).
What are the key properties of 3-[3-(2-aminoethyl)cyclohexa-1,3-dien-1-yl]-4,5-dihydro-1H-pyridazin-6-one?
3-[3-(2-aminoethyl)cyclohexa-1,3-dien-1-yl]-4,5-dihydro-1H-pyridazin-6-one has a molecular weight of 219.29 g/mol, XLogP of 1.25, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(2-aminoethyl)cyclohexa-1,3-dien-1-yl]-4,5-dihydro-1H-pyridazin-6-one is sourced from PubChem (CID 155148873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).