C43H34F4O2P2 — CID 155148915
[(1R,10R)-13-bis(4-fluorophenyl)phosphanyl-2,11-dioxatetracyclo[8.8.3.03,8.012,17]henicosa-3(8),4,6,12(17),13,15-hexaen-4-yl]-bis(4-fluorophenyl)phosphane (PubChem CID 155148915) has the molecular formula C43H34F4O2P2 and a molecular weight of 720.68 g/mol. Its IUPAC name is [(1R,10R)-13-bis(4-fluorophenyl)phosphanyl-2,11-dioxatetracyclo[8.8.3.03,8.012,17]henicosa-3(8),4,6,12(17),13,15-hexaen-4-yl]-bis(4-fluorophenyl)phosphane.
| Compound Name | [(1R,10R)-13-bis(4-fluorophenyl)phosphanyl-2,11-dioxatetracyclo[8.8.3.03,8.012,17]henicosa-3(8),4,6,12(17),13,15-hexaen-4-yl]-bis(4-fluorophenyl)phosphane |
|---|---|
| PubChem CID | 155148915 |
| Molecular Formula | C43H34F4O2P2 |
| Molecular Weight | 720.68 g/mol |
| Exact Mass | 720.20 |
| IUPAC Name | [(1R,10R)-13-bis(4-fluorophenyl)phosphanyl-2,11-dioxatetracyclo[8.8.3.03,8.012,17]henicosa-3(8),4,6,12(17),13,15-hexaen-4-yl]-bis(4-fluorophenyl)phosphane |
| SMILES | Fc1ccc(P(c2ccc(F)cc2)c2cccc3c2O[C@@H]2CCC[C@H](C3)Oc3c(cccc3P(c3ccc(F)cc3)c3ccc(F)cc3)C2)cc1 |
| InChI | InChI=1S/C43H34F4O2P2/c44-30-10-18-36(19-11-30)50(37-20-12-31(45)13-21-37)40-8-1-4-28-26-34-6-3-7-35(48-42(28)40)27-29-5-2-9-41(43(29)49-34)51(38-22-14-32(46)15-23-38)39-24-16-33(47)17-25-39/h1-2,4-5,8-25,34-35H,3,6-7,26-27H2/t34-,35-/m1/s1 |
| InChIKey | UOKVDJNJUUBSJQ-VSJLXWSYSA-N |
| XLogP | 8.24 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.68 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|