C28H31FO3 — CID 155148955
3-[[4-[4-fluoro-3-[[(3E,5Z)-octa-3,5-dien-7-yn-4-yl]oxymethyl]phenyl]-3,5-dimethylphenoxy]methyl]-3-methyloxetane (PubChem CID 155148955) has the molecular formula C28H31FO3 and a molecular weight of 434.55 g/mol. Its IUPAC name is 3-[[4-[4-fluoro-3-[[(3E,5Z)-octa-3,5-dien-7-yn-4-yl]oxymethyl]phenyl]-3,5-dimethylphenoxy]methyl]-3-methyloxetane.
| Compound Name | 3-[[4-[4-fluoro-3-[[(3E,5Z)-octa-3,5-dien-7-yn-4-yl]oxymethyl]phenyl]-3,5-dimethylphenoxy]methyl]-3-methyloxetane |
|---|---|
| PubChem CID | 155148955 |
| Molecular Formula | C28H31FO3 |
| Molecular Weight | 434.55 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | 3-[[4-[4-fluoro-3-[[(3E,5Z)-octa-3,5-dien-7-yn-4-yl]oxymethyl]phenyl]-3,5-dimethylphenoxy]methyl]-3-methyloxetane |
| SMILES | C#C/C=C\C(=C/CC)OCc1cc(-c2c(C)cc(OCC3(C)COC3)cc2C)ccc1F |
| InChI | InChI=1S/C28H31FO3/c1-6-8-10-24(9-7-2)31-16-23-15-22(11-12-26(23)29)27-20(3)13-25(14-21(27)4)32-19-28(5)17-30-18-28/h1,8-15H,7,16-19H2,2-5H3/b10-8-,24-9+ |
| InChIKey | JPKCXMZWNDZKHT-AXSAGLPFSA-N |
| XLogP | 6.52 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.55 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|