C30H28F5NO4 — CID 155149058
2-[4-[[2-fluoro-5-[2-methyl-6-(2,3,3,3-tetrafluoro-2-methylpropoxy)-3-pyridinyl]phenyl]methoxy]-3-methylidene-1a,4,6,6a-tetrahydro-1H-cyclopropa[a]inden-1-yl]oxiran-2-ol (PubChem CID 155149058) has the molecular formula C30H28F5NO4 and a molecular weight of 561.55 g/mol. Its IUPAC name is 2-[4-[[2-fluoro-5-[2-methyl-6-(2,3,3,3-tetrafluoro-2-methylpropoxy)-3-pyridinyl]phenyl]methoxy]-3-methylidene-1a,4,6,6a-tetrahydro-1H-cyclopropa[a]inden-1-yl]oxiran-2-ol.
| Compound Name | 2-[4-[[2-fluoro-5-[2-methyl-6-(2,3,3,3-tetrafluoro-2-methylpropoxy)-3-pyridinyl]phenyl]methoxy]-3-methylidene-1a,4,6,6a-tetrahydro-1H-cyclopropa[a]inden-1-yl]oxiran-2-ol |
|---|---|
| PubChem CID | 155149058 |
| Molecular Formula | C30H28F5NO4 |
| Molecular Weight | 561.55 g/mol |
| Exact Mass | 561.19 |
| IUPAC Name | 2-[4-[[2-fluoro-5-[2-methyl-6-(2,3,3,3-tetrafluoro-2-methylpropoxy)-3-pyridinyl]phenyl]methoxy]-3-methylidene-1a,4,6,6a-tetrahydro-1H-cyclopropa[a]inden-1-yl]oxiran-2-ol |
| SMILES | C=C1C=C2C(=CC1OCc1cc(-c3ccc(OCC(C)(F)C(F)(F)F)nc3C)ccc1F)CC1C2C1C1(O)CO1 |
| InChI | InChI=1S/C30H28F5NO4/c1-15-8-21-18(10-22-26(21)27(22)29(37)14-40-29)11-24(15)38-12-19-9-17(4-6-23(19)31)20-5-7-25(36-16(20)2)39-13-28(3,32)30(33,34)35/h4-9,11,22,24,26-27,37H,1,10,12-14H2,2-3H3 |
| InChIKey | COAGYLLVOAKWCQ-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.55 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|