About (2Z,4E)-1-iminohepta-2,4-dien-3-amine
(2Z,4E)-1-iminohepta-2,4-dien-3-amine (PubChem CID 155149105) has the molecular formula C7H12N2
and a molecular weight of 124.19 g/mol. Its IUPAC name is (2Z,4E)-1-iminohepta-2,4-dien-3-amine.
Molecular Properties
| Compound Name | (2Z,4E)-1-iminohepta-2,4-dien-3-amine |
| PubChem CID | 155149105 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | (2Z,4E)-1-iminohepta-2,4-dien-3-amine |
| SMILES | [H]/N=C/C=C(N)/C=C/CC |
| InChI | InChI=1S/C7H12N2/c1-2-3-4-7(9)5-6-8/h3-6,8H,2,9H2,1H3/b4-3+,7-5-,8-6+ |
| InChIKey | QCPMDOIPRXWGEO-BLEWUHOTSA-N |
| XLogP | 1.44 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2Z,4E)-1-iminohepta-2,4-dien-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z,4E)-1-iminohepta-2,4-dien-3-amine?
The IUPAC name of (2Z,4E)-1-iminohepta-2,4-dien-3-amine (CID 155149105) is (2Z,4E)-1-iminohepta-2,4-dien-3-amine.
What is the SMILES notation for (2Z,4E)-1-iminohepta-2,4-dien-3-amine?
The canonical SMILES for (2Z,4E)-1-iminohepta-2,4-dien-3-amine is [H]/N=C/C=C(N)/C=C/CC.
What is the InChIKey of (2Z,4E)-1-iminohepta-2,4-dien-3-amine?
The InChIKey is QCPMDOIPRXWGEO-BLEWUHOTSA-N. The full InChI is InChI=1S/C7H12N2/c1-2-3-4-7(9)5-6-8/h3-6,8H,2,9H2,1H3/b4-3+,7-5-,8-6+.
What are the key properties of (2Z,4E)-1-iminohepta-2,4-dien-3-amine?
(2Z,4E)-1-iminohepta-2,4-dien-3-amine has a molecular weight of 124.19 g/mol, XLogP of 1.44, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,4E)-1-iminohepta-2,4-dien-3-amine is sourced from PubChem (CID 155149105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).