C14H17FN2 — CID 155149119
2-[(3Z)-3-[(2E)-3-fluorohexa-2,5-dienylidene]-1,2-dihydropyrrol-4-yl]-2-methylpropanenitrile (PubChem CID 155149119) has the molecular formula C14H17FN2 and a molecular weight of 232.30 g/mol. Its IUPAC name is 2-[(3Z)-3-[(2E)-3-fluorohexa-2,5-dienylidene]-1,2-dihydropyrrol-4-yl]-2-methylpropanenitrile.
| Compound Name | 2-[(3Z)-3-[(2E)-3-fluorohexa-2,5-dienylidene]-1,2-dihydropyrrol-4-yl]-2-methylpropanenitrile |
|---|---|
| PubChem CID | 155149119 |
| Molecular Formula | C14H17FN2 |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | 2-[(3Z)-3-[(2E)-3-fluorohexa-2,5-dienylidene]-1,2-dihydropyrrol-4-yl]-2-methylpropanenitrile |
| SMILES | C=CC/C(F)=C\C=C1/CNC=C1C(C)(C)C#N |
| InChI | InChI=1S/C14H17FN2/c1-4-5-12(15)7-6-11-8-17-9-13(11)14(2,3)10-16/h4,6-7,9,17H,1,5,8H2,2-3H3/b11-6+,12-7+ |
| InChIKey | OVZWQNKPRMBJGB-GNXRPPCSSA-N |
| XLogP | 3.38 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|