C21H30FN — CID 155149429
1-(3,5-dimethylcyclohexen-1-yl)-8-fluoro-4a,5,6,6a,7,8,9,10,10a,10b-decahydrobenzo[h]isoquinoline (PubChem CID 155149429) has the molecular formula C21H30FN and a molecular weight of 315.48 g/mol. Its IUPAC name is 1-(3,5-dimethylcyclohexen-1-yl)-8-fluoro-4a,5,6,6a,7,8,9,10,10a,10b-decahydrobenzo[h]isoquinoline.
| Compound Name | 1-(3,5-dimethylcyclohexen-1-yl)-8-fluoro-4a,5,6,6a,7,8,9,10,10a,10b-decahydrobenzo[h]isoquinoline |
|---|---|
| PubChem CID | 155149429 |
| Molecular Formula | C21H30FN |
| Molecular Weight | 315.48 g/mol |
| Exact Mass | 315.24 |
| IUPAC Name | 1-(3,5-dimethylcyclohexen-1-yl)-8-fluoro-4a,5,6,6a,7,8,9,10,10a,10b-decahydrobenzo[h]isoquinoline |
| SMILES | CC1C=C(C2=NC=CC3CCC4CC(F)CCC4C23)CC(C)C1 |
| InChI | InChI=1S/C21H30FN/c1-13-9-14(2)11-17(10-13)21-20-15(7-8-23-21)3-4-16-12-18(22)5-6-19(16)20/h7-8,10,13-16,18-20H,3-6,9,11-12H2,1-2H3 |
| InChIKey | IYIFBEACQJKSTR-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.48 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |