C23H32FN — CID 155149479
(1aS,3aR,7bS)-3-[1-[(5R)-5-fluoro-2-propylcyclohexa-1,3-dien-1-yl]ethyl]-5,7-dimethyl-1a,2,3,3a,7a,7b-hexahydro-1H-cyclopropa[c]isoquinoline (PubChem CID 155149479) has the molecular formula C23H32FN and a molecular weight of 341.51 g/mol. Its IUPAC name is (1aS,3aR,7bS)-3-[1-[(5R)-5-fluoro-2-propylcyclohexa-1,3-dien-1-yl]ethyl]-5,7-dimethyl-1a,2,3,3a,7a,7b-hexahydro-1H-cyclopropa[c]isoquinoline.
| Compound Name | (1aS,3aR,7bS)-3-[1-[(5R)-5-fluoro-2-propylcyclohexa-1,3-dien-1-yl]ethyl]-5,7-dimethyl-1a,2,3,3a,7a,7b-hexahydro-1H-cyclopropa[c]isoquinoline |
|---|---|
| PubChem CID | 155149479 |
| Molecular Formula | C23H32FN |
| Molecular Weight | 341.51 g/mol |
| Exact Mass | 341.25 |
| IUPAC Name | (1aS,3aR,7bS)-3-[1-[(5R)-5-fluoro-2-propylcyclohexa-1,3-dien-1-yl]ethyl]-5,7-dimethyl-1a,2,3,3a,7a,7b-hexahydro-1H-cyclopropa[c]isoquinoline |
| SMILES | CCCC1=C(C(C)C2N[C@H]3C[C@H]3C3C(C)=CC(C)=C[C@@H]23)C[C@@H](F)C=C1 |
| InChI | InChI=1S/C23H32FN/c1-5-6-16-7-8-17(24)11-18(16)15(4)23-20-10-13(2)9-14(3)22(20)19-12-21(19)25-23/h7-10,15,17,19-23,25H,5-6,11-12H2,1-4H3/t15?,17-,19+,20+,21-,22?,23?/m0/s1 |
| InChIKey | NGIFBZJTPWNAAH-ZLVMEKEJSA-N |
| XLogP | 5.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.51 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |