About (2-oxochromen-6-yl)oxy thiohypofluorite
(2-oxochromen-6-yl)oxy thiohypofluorite (PubChem CID 155149522) has the molecular formula C9H5FO3S
and a molecular weight of 212.20 g/mol. Its IUPAC name is (2-oxochromen-6-yl)oxy thiohypofluorite.
Molecular Properties
| Compound Name | (2-oxochromen-6-yl)oxy thiohypofluorite |
| PubChem CID | 155149522 |
| Molecular Formula | C9H5FO3S |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 211.99 |
| IUPAC Name | (2-oxochromen-6-yl)oxy thiohypofluorite |
| SMILES | O=c1ccc2cc(OSF)ccc2o1 |
| InChI | InChI=1S/C9H5FO3S/c10-14-13-7-2-3-8-6(5-7)1-4-9(11)12-8/h1-5H |
| InChIKey | ZALBSGSPQKOGHX-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-oxochromen-6-yl)oxy thiohypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxochromen-6-yl)oxy thiohypofluorite?
The IUPAC name of (2-oxochromen-6-yl)oxy thiohypofluorite (CID 155149522) is (2-oxochromen-6-yl)oxy thiohypofluorite.
What is the SMILES notation for (2-oxochromen-6-yl)oxy thiohypofluorite?
The canonical SMILES for (2-oxochromen-6-yl)oxy thiohypofluorite is O=c1ccc2cc(OSF)ccc2o1.
What is the InChIKey of (2-oxochromen-6-yl)oxy thiohypofluorite?
The InChIKey is ZALBSGSPQKOGHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5FO3S/c10-14-13-7-2-3-8-6(5-7)1-4-9(11)12-8/h1-5H.
What are the key properties of (2-oxochromen-6-yl)oxy thiohypofluorite?
(2-oxochromen-6-yl)oxy thiohypofluorite has a molecular weight of 212.20 g/mol, XLogP of 2.70, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxochromen-6-yl)oxy thiohypofluorite is sourced from PubChem (CID 155149522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).