C21H26F3N5O2 — CID 155149749
3-[1-[cyclopropyl-[4-(1,1-difluoroethyl)-2-fluorophenyl]methyl]-4-formyl-3-(hydroxymethyl)pyrazol-5-yl]-1,1,2-trimethylguanidine (PubChem CID 155149749) has the molecular formula C21H26F3N5O2 and a molecular weight of 437.47 g/mol. Its IUPAC name is 3-[1-[cyclopropyl-[4-(1,1-difluoroethyl)-2-fluorophenyl]methyl]-4-formyl-3-(hydroxymethyl)pyrazol-5-yl]-1,1,2-trimethylguanidine.
| Compound Name | 3-[1-[cyclopropyl-[4-(1,1-difluoroethyl)-2-fluorophenyl]methyl]-4-formyl-3-(hydroxymethyl)pyrazol-5-yl]-1,1,2-trimethylguanidine |
|---|---|
| PubChem CID | 155149749 |
| Molecular Formula | C21H26F3N5O2 |
| Molecular Weight | 437.47 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | 3-[1-[cyclopropyl-[4-(1,1-difluoroethyl)-2-fluorophenyl]methyl]-4-formyl-3-(hydroxymethyl)pyrazol-5-yl]-1,1,2-trimethylguanidine |
| SMILES | C/N=C(/Nc1c(C=O)c(CO)nn1C(c1ccc(C(C)(F)F)cc1F)C1CC1)N(C)C |
| InChI | InChI=1S/C21H26F3N5O2/c1-21(23,24)13-7-8-14(16(22)9-13)18(12-5-6-12)29-19(26-20(25-2)28(3)4)15(10-30)17(11-31)27-29/h7-10,12,18,31H,5-6,11H2,1-4H3,(H,25,26) |
| InChIKey | ANCJMJLYTZZZSR-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.47 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|