C14H18S — CID 155150546
(3E,5E)-3-[(1E,3Z)-4-methylhexa-1,3,5-trienyl]sulfanylhepta-1,3,5-triene (PubChem CID 155150546) has the molecular formula C14H18S and a molecular weight of 218.36 g/mol. Its IUPAC name is (3E,5E)-3-[(1E,3Z)-4-methylhexa-1,3,5-trienyl]sulfanylhepta-1,3,5-triene.
| Compound Name | (3E,5E)-3-[(1E,3Z)-4-methylhexa-1,3,5-trienyl]sulfanylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 155150546 |
| Molecular Formula | C14H18S |
| Molecular Weight | 218.36 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | (3E,5E)-3-[(1E,3Z)-4-methylhexa-1,3,5-trienyl]sulfanylhepta-1,3,5-triene |
| SMILES | C=C/C(C)=C\C=C\S/C(C=C)=C/C=C/C |
| InChI | InChI=1S/C14H18S/c1-5-8-11-14(7-3)15-12-9-10-13(4)6-2/h5-12H,2-3H2,1,4H3/b8-5+,12-9+,13-10-,14-11+ |
| InChIKey | KJNXTYDJGLZPAF-GDBBUWORSA-N |
| XLogP | 5.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.36 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|