C26H39NO2 — CID 155150563
(3'R,4aR,6aR,6bS,7'aR,9S)-3',11-dimethylspiro[1,2,4,4a,5,6,6a,6b,7,8,10,12,12a,12b-tetradecahydronaphtho[2,1-a]azulene-9,2'-3a,4,5,6,7,7a-hexahydro-3H-furo[3,2-b]pyridine]-3-one (PubChem CID 155150563) has the molecular formula C26H39NO2 and a molecular weight of 397.60 g/mol. Its IUPAC name is (3'R,4aR,6aR,6bS,7'aR,9S)-3',11-dimethylspiro[1,2,4,4a,5,6,6a,6b,7,8,10,12,12a,12b-tetradecahydronaphtho[2,1-a]azulene-9,2'-3a,4,5,6,7,7a-hexahydro-3H-furo[3,2-b]pyridine]-3-one.
| Compound Name | (3'R,4aR,6aR,6bS,7'aR,9S)-3',11-dimethylspiro[1,2,4,4a,5,6,6a,6b,7,8,10,12,12a,12b-tetradecahydronaphtho[2,1-a]azulene-9,2'-3a,4,5,6,7,7a-hexahydro-3H-furo[3,2-b]pyridine]-3-one |
|---|---|
| PubChem CID | 155150563 |
| Molecular Formula | C26H39NO2 |
| Molecular Weight | 397.60 g/mol |
| Exact Mass | 397.30 |
| IUPAC Name | (3'R,4aR,6aR,6bS,7'aR,9S)-3',11-dimethylspiro[1,2,4,4a,5,6,6a,6b,7,8,10,12,12a,12b-tetradecahydronaphtho[2,1-a]azulene-9,2'-3a,4,5,6,7,7a-hexahydro-3H-furo[3,2-b]pyridine]-3-one |
| SMILES | CC1=C2CC3C4CCC(=O)C[C@H]4CC[C@H]3[C@@H]2CC[C@@]2(C1)O[C@@H]1CCCNC1[C@H]2C |
| InChI | InChI=1S/C26H39NO2/c1-15-14-26(16(2)25-24(29-26)4-3-11-27-25)10-9-21-20-7-5-17-12-18(28)6-8-19(17)23(20)13-22(15)21/h16-17,19-21,23-25,27H,3-14H2,1-2H3/t16-,17-,19?,20+,21+,23?,24-,25?,26+/m1/s1 |
| InChIKey | ZQGWQHWACVVXOM-DQSPOKOTSA-N |
| XLogP | 5.04 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.60 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|