C35H66FN7O2 — CID 155150628
N-[3-butyl-5-cyclopropyl-4-[4-[(3S)-oxolan-3-yl]piperazin-1-yl]-4,5-dihydro-2H-pyridin-3-yl]-2-(diaminomethyl)-3-(2-fluorobutylamino)-4-methylnonanamide (PubChem CID 155150628) has the molecular formula C35H66FN7O2 and a molecular weight of 635.96 g/mol. Its IUPAC name is N-[3-butyl-5-cyclopropyl-4-[4-[(3S)-oxolan-3-yl]piperazin-1-yl]-4,5-dihydro-2H-pyridin-3-yl]-2-(diaminomethyl)-3-(2-fluorobutylamino)-4-methylnonanamide.
| Compound Name | N-[3-butyl-5-cyclopropyl-4-[4-[(3S)-oxolan-3-yl]piperazin-1-yl]-4,5-dihydro-2H-pyridin-3-yl]-2-(diaminomethyl)-3-(2-fluorobutylamino)-4-methylnonanamide |
|---|---|
| PubChem CID | 155150628 |
| Molecular Formula | C35H66FN7O2 |
| Molecular Weight | 635.96 g/mol |
| Exact Mass | 635.53 |
| IUPAC Name | N-[3-butyl-5-cyclopropyl-4-[4-[(3S)-oxolan-3-yl]piperazin-1-yl]-4,5-dihydro-2H-pyridin-3-yl]-2-(diaminomethyl)-3-(2-fluorobutylamino)-4-methylnonanamide |
| SMILES | CCCCCC(C)C(NCC(F)CC)C(C(=O)NC1(CCCC)CN=CC(C2CC2)C1N1CCN([C@H]2CCOC2)CC1)C(N)N |
| InChI | InChI=1S/C35H66FN7O2/c1-5-8-10-11-25(4)31(40-21-27(36)7-3)30(33(37)38)34(44)41-35(15-9-6-2)24-39-22-29(26-12-13-26)32(35)43-18-16-42(17-19-43)28-14-20-45-23-28/h22,25-33,40H,5-21,23-24,37-38H2,1-4H3,(H,41,44)/t25?,27?,28-,29?,30?,31?,32?,35?/m0/s1 |
| InChIKey | YDCOWFGPMNMGSV-MEKBCIKGSA-N |
| XLogP | 3.70 |
| TPSA | 121.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.96 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|