About (4-methoxy-6-methyl-1,3,5-triazin-2-yl)methanamine
(4-methoxy-6-methyl-1,3,5-triazin-2-yl)methanamine (PubChem CID 15515077) has the molecular formula C6H10N4O
and a molecular weight of 154.17 g/mol. Its IUPAC name is (4-methoxy-6-methyl-1,3,5-triazin-2-yl)methanamine.
Molecular Properties
| Compound Name | (4-methoxy-6-methyl-1,3,5-triazin-2-yl)methanamine |
| PubChem CID | 15515077 |
| Molecular Formula | C6H10N4O |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.09 |
| IUPAC Name | (4-methoxy-6-methyl-1,3,5-triazin-2-yl)methanamine |
| SMILES | COc1nc(C)nc(CN)n1 |
| InChI | InChI=1S/C6H10N4O/c1-4-8-5(3-7)10-6(9-4)11-2/h3,7H2,1-2H3 |
| InChIKey | CDJPDRFZLNASLL-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 73.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4-methoxy-6-methyl-1,3,5-triazin-2-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methoxy-6-methyl-1,3,5-triazin-2-yl)methanamine?
The IUPAC name of (4-methoxy-6-methyl-1,3,5-triazin-2-yl)methanamine (CID 15515077) is (4-methoxy-6-methyl-1,3,5-triazin-2-yl)methanamine.
What is the SMILES notation for (4-methoxy-6-methyl-1,3,5-triazin-2-yl)methanamine?
The canonical SMILES for (4-methoxy-6-methyl-1,3,5-triazin-2-yl)methanamine is COc1nc(C)nc(CN)n1.
What is the InChIKey of (4-methoxy-6-methyl-1,3,5-triazin-2-yl)methanamine?
The InChIKey is CDJPDRFZLNASLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N4O/c1-4-8-5(3-7)10-6(9-4)11-2/h3,7H2,1-2H3.
What are the key properties of (4-methoxy-6-methyl-1,3,5-triazin-2-yl)methanamine?
(4-methoxy-6-methyl-1,3,5-triazin-2-yl)methanamine has a molecular weight of 154.17 g/mol, XLogP of -0.35, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxy-6-methyl-1,3,5-triazin-2-yl)methanamine is sourced from PubChem (CID 15515077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).