C26H42FN7O2 — CID 155150792
3,3-diamino-2-[(7Z)-1-ethyl-6-fluoro-4-azabicyclo[6.1.0]nona-4,7-dien-3-yl]-N-[4-(6-oxo-3,4,7,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-2-yl)piperidin-3-yl]propanamide (PubChem CID 155150792) has the molecular formula C26H42FN7O2 and a molecular weight of 503.67 g/mol. Its IUPAC name is 3,3-diamino-2-[(7Z)-1-ethyl-6-fluoro-4-azabicyclo[6.1.0]nona-4,7-dien-3-yl]-N-[4-(6-oxo-3,4,7,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-2-yl)piperidin-3-yl]propanamide.
| Compound Name | 3,3-diamino-2-[(7Z)-1-ethyl-6-fluoro-4-azabicyclo[6.1.0]nona-4,7-dien-3-yl]-N-[4-(6-oxo-3,4,7,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-2-yl)piperidin-3-yl]propanamide |
|---|---|
| PubChem CID | 155150792 |
| Molecular Formula | C26H42FN7O2 |
| Molecular Weight | 503.67 g/mol |
| Exact Mass | 503.34 |
| IUPAC Name | 3,3-diamino-2-[(7Z)-1-ethyl-6-fluoro-4-azabicyclo[6.1.0]nona-4,7-dien-3-yl]-N-[4-(6-oxo-3,4,7,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-2-yl)piperidin-3-yl]propanamide |
| SMILES | CCC12C/C1=C/C(F)/C=N\C(C(C(=O)NC1CNCCC1N1CCN3C(=O)CCCC3C1)C(N)N)C2 |
| InChI | InChI=1S/C26H42FN7O2/c1-2-26-11-16(26)10-17(27)13-31-19(12-26)23(24(28)29)25(36)32-20-14-30-7-6-21(20)33-8-9-34-18(15-33)4-3-5-22(34)35/h10,13,17-21,23-24,30H,2-9,11-12,14-15,28-29H2,1H3,(H,32,36)/b16-10-,31-13- |
| InChIKey | ABRDMUMUGFOIKL-XCADULNHSA-N |
| XLogP | 0.30 |
| TPSA | 129.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.67 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|