C30H55ClN6O2 — CID 155150826
3,3-diamino-N-[6-chloro-4-[(2S)-heptan-2-yl]-4-methoxypiperidin-3-yl]-2-[11-(cyanomethyl)-9-azaspiro[5.7]tridecan-8-yl]propanamide (PubChem CID 155150826) has the molecular formula C30H55ClN6O2 and a molecular weight of 567.26 g/mol. Its IUPAC name is 3,3-diamino-N-[6-chloro-4-[(2S)-heptan-2-yl]-4-methoxypiperidin-3-yl]-2-[11-(cyanomethyl)-9-azaspiro[5.7]tridecan-8-yl]propanamide.
| Compound Name | 3,3-diamino-N-[6-chloro-4-[(2S)-heptan-2-yl]-4-methoxypiperidin-3-yl]-2-[11-(cyanomethyl)-9-azaspiro[5.7]tridecan-8-yl]propanamide |
|---|---|
| PubChem CID | 155150826 |
| Molecular Formula | C30H55ClN6O2 |
| Molecular Weight | 567.26 g/mol |
| Exact Mass | 566.41 |
| IUPAC Name | 3,3-diamino-N-[6-chloro-4-[(2S)-heptan-2-yl]-4-methoxypiperidin-3-yl]-2-[11-(cyanomethyl)-9-azaspiro[5.7]tridecan-8-yl]propanamide |
| SMILES | CCCCC[C@H](C)C1(OC)CC(Cl)NCC1NC(=O)C(C(N)N)C1CC2(CCCCC2)CCC(CC#N)CN1 |
| InChI | InChI=1S/C30H55ClN6O2/c1-4-5-7-10-21(2)30(39-3)18-25(31)36-20-24(30)37-28(38)26(27(33)34)23-17-29(13-8-6-9-14-29)15-11-22(12-16-32)19-35-23/h21-27,35-36H,4-15,17-20,33-34H2,1-3H3,(H,37,38)/t21-,22?,23?,24?,25?,26?,30?/m0/s1 |
| InChIKey | ZWFRZDUIQTTYOR-VFVQLDMPSA-N |
| XLogP | 4.11 |
| TPSA | 138.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.26 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|